C17H18Cl2FNO3S — CID 139932053
4-chloro-N-(5-chloro-2-fluorophenyl)-N-[(2R)-2-hydroxy-3-methylbutyl]benzenesulfonamide (PubChem CID 139932053) has the molecular formula C17H18Cl2FNO3S and a molecular weight of 406.31 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-fluorophenyl)-N-[(2R)-2-hydroxy-3-methylbutyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-chloro-2-fluorophenyl)-N-[(2R)-2-hydroxy-3-methylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139932053 |
| Molecular Formula | C17H18Cl2FNO3S |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-fluorophenyl)-N-[(2R)-2-hydroxy-3-methylbutyl]benzenesulfonamide |
| SMILES | CC(C)[C@@H](O)CN(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2FNO3S/c1-11(2)17(22)10-21(16-9-13(19)5-8-15(16)20)25(23,24)14-6-3-12(18)4-7-14/h3-9,11,17,22H,10H2,1-2H3/t17-/m0/s1 |
| InChIKey | QSPVKRLYTYFDSA-KRWDZBQOSA-N |
| XLogP | 4.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |