C17H17Cl2NO3S — CID 91353524
2-[benzenesulfonyl(2-methylpropyl)amino]-5-chlorobenzoyl chloride (PubChem CID 91353524) has the molecular formula C17H17Cl2NO3S and a molecular weight of 386.30 g/mol. Its IUPAC name is 2-[benzenesulfonyl(2-methylpropyl)amino]-5-chlorobenzoyl chloride.
| Compound Name | 2-[benzenesulfonyl(2-methylpropyl)amino]-5-chlorobenzoyl chloride |
|---|---|
| PubChem CID | 91353524 |
| Molecular Formula | C17H17Cl2NO3S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-[benzenesulfonyl(2-methylpropyl)amino]-5-chlorobenzoyl chloride |
| SMILES | CC(C)CN(c1ccc(Cl)cc1C(=O)Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17Cl2NO3S/c1-12(2)11-20(24(22,23)14-6-4-3-5-7-14)16-9-8-13(18)10-15(16)17(19)21/h3-10,12H,11H2,1-2H3 |
| InChIKey | NWCLZCNPRULADT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|