C21H21NO4S2 — CID 91386899
3-[benzenesulfonyl(2-methylpropyl)amino]-5-phenylthiophene-2-carboxylic acid (PubChem CID 91386899) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[benzenesulfonyl(2-methylpropyl)amino]-5-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[benzenesulfonyl(2-methylpropyl)amino]-5-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 91386899 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3-[benzenesulfonyl(2-methylpropyl)amino]-5-phenylthiophene-2-carboxylic acid |
| SMILES | CC(C)CN(c1cc(-c2ccccc2)sc1C(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO4S2/c1-15(2)14-22(28(25,26)17-11-7-4-8-12-17)18-13-19(27-20(18)21(23)24)16-9-5-3-6-10-16/h3-13,15H,14H2,1-2H3,(H,23,24) |
| InChIKey | XVFJSASDHYHTNM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |