C20H25NOS — CID 123927746
4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-prop-2-enylpentanamide (PubChem CID 123927746) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is 4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-prop-2-enylpentanamide.
| Compound Name | 4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-prop-2-enylpentanamide |
|---|---|
| PubChem CID | 123927746 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-methyl-N-(2-methyl-5-phenylthiophen-3-yl)-N-prop-2-enylpentanamide |
| SMILES | C=CCN(C(=O)CCC(C)C)c1cc(-c2ccccc2)sc1C |
| InChI | InChI=1S/C20H25NOS/c1-5-13-21(20(22)12-11-15(2)3)18-14-19(23-16(18)4)17-9-7-6-8-10-17/h5-10,14-15H,1,11-13H2,2-4H3 |
| InChIKey | ACLNFFLSLNGVNP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|