C21H20ClNO3S — CID 142192441
N-[(3-chlorophenyl)methyl]-N-(2-methyl-5-phenylthiophen-3-yl)acetamide;formic acid (PubChem CID 142192441) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-(2-methyl-5-phenylthiophen-3-yl)acetamide;formic acid.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-(2-methyl-5-phenylthiophen-3-yl)acetamide;formic acid |
|---|---|
| PubChem CID | 142192441 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-(2-methyl-5-phenylthiophen-3-yl)acetamide;formic acid |
| SMILES | CC(=O)N(Cc1cccc(Cl)c1)c1cc(-c2ccccc2)sc1C.O=CO |
| InChI | InChI=1S/C20H18ClNOS.CH2O2/c1-14-19(12-20(24-14)17-8-4-3-5-9-17)22(15(2)23)13-16-7-6-10-18(21)11-16;2-1-3/h3-12H,13H2,1-2H3;1H,(H,2,3) |
| InChIKey | OAZUQCRBSMKSQG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|