C20H23Cl2NO5S — CID 70131088
[4-chloro-2-[(4-chlorophenyl)sulfonyl-[(4R)-4-hydroxypentyl]amino]phenyl]methyl acetate (PubChem CID 70131088) has the molecular formula C20H23Cl2NO5S and a molecular weight of 460.38 g/mol. Its IUPAC name is [4-chloro-2-[(4-chlorophenyl)sulfonyl-[(4R)-4-hydroxypentyl]amino]phenyl]methyl acetate.
| Compound Name | [4-chloro-2-[(4-chlorophenyl)sulfonyl-[(4R)-4-hydroxypentyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 70131088 |
| Molecular Formula | C20H23Cl2NO5S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | [4-chloro-2-[(4-chlorophenyl)sulfonyl-[(4R)-4-hydroxypentyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(Cl)cc1N(CCC[C@@H](C)O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23Cl2NO5S/c1-14(24)4-3-11-23(29(26,27)19-9-7-17(21)8-10-19)20-12-18(22)6-5-16(20)13-28-15(2)25/h5-10,12,14,24H,3-4,11,13H2,1-2H3/t14-/m1/s1 |
| InChIKey | SYVCVFZYMLUWDE-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |