C21H26Cl2N2O6S — CID 142014094
4-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butyl N-(2-hydroxyethyl)-N-methylcarbamate (PubChem CID 142014094) has the molecular formula C21H26Cl2N2O6S and a molecular weight of 505.42 g/mol. Its IUPAC name is 4-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butyl N-(2-hydroxyethyl)-N-methylcarbamate.
| Compound Name | 4-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butyl N-(2-hydroxyethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 142014094 |
| Molecular Formula | C21H26Cl2N2O6S |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 4-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butyl N-(2-hydroxyethyl)-N-methylcarbamate |
| SMILES | CN(CCO)C(=O)OCCCCN(c1cc(Cl)ccc1CO)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26Cl2N2O6S/c1-24(11-12-26)21(28)31-13-3-2-10-25(20-14-18(23)5-4-16(20)15-27)32(29,30)19-8-6-17(22)7-9-19/h4-9,14,26-27H,2-3,10-13,15H2,1H3 |
| InChIKey | AHXAIRQJUTUDDJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|