C24H25Cl2NO3S2 — CID 22275146
4-chloro-N-[5-chloro-2-(hydroxymethyl)phenyl]-N-(5-phenylsulfanylpentan-2-yl)benzenesulfonamide (PubChem CID 22275146) has the molecular formula C24H25Cl2NO3S2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 4-chloro-N-[5-chloro-2-(hydroxymethyl)phenyl]-N-(5-phenylsulfanylpentan-2-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[5-chloro-2-(hydroxymethyl)phenyl]-N-(5-phenylsulfanylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22275146 |
| Molecular Formula | C24H25Cl2NO3S2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 4-chloro-N-[5-chloro-2-(hydroxymethyl)phenyl]-N-(5-phenylsulfanylpentan-2-yl)benzenesulfonamide |
| SMILES | CC(CCCSc1ccccc1)N(c1cc(Cl)ccc1CO)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25Cl2NO3S2/c1-18(6-5-15-31-22-7-3-2-4-8-22)27(24-16-21(26)10-9-19(24)17-28)32(29,30)23-13-11-20(25)12-14-23/h2-4,7-14,16,18,28H,5-6,15,17H2,1H3 |
| InChIKey | VOAQADHIBWXDBE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|