C22H26Cl3NO4S — CID 22275971
tert-butyl 5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexanoate (PubChem CID 22275971) has the molecular formula C22H26Cl3NO4S and a molecular weight of 506.88 g/mol. Its IUPAC name is tert-butyl 5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexanoate.
| Compound Name | tert-butyl 5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexanoate |
|---|---|
| PubChem CID | 22275971 |
| Molecular Formula | C22H26Cl3NO4S |
| Molecular Weight | 506.88 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | tert-butyl 5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexanoate |
| SMILES | CC(CCCC(=O)OC(C)(C)C)N(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26Cl3NO4S/c1-15(6-5-7-21(27)30-22(2,3)4)26(20-14-17(24)10-13-19(20)25)31(28,29)18-11-8-16(23)9-12-18/h8-15H,5-7H2,1-4H3 |
| InChIKey | RFABZRTUQXHOHS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.88 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |