C25H33Cl3N2O4S2 — CID 54177211
4-chloro-N-(2,5-dichlorophenyl)-N-[6-[(2R)-2-(methylsulfonylmethyl)piperidin-1-yl]hexan-2-yl]benzenesulfonamide (PubChem CID 54177211) has the molecular formula C25H33Cl3N2O4S2 and a molecular weight of 596.04 g/mol. Its IUPAC name is 4-chloro-N-(2,5-dichlorophenyl)-N-[6-[(2R)-2-(methylsulfonylmethyl)piperidin-1-yl]hexan-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,5-dichlorophenyl)-N-[6-[(2R)-2-(methylsulfonylmethyl)piperidin-1-yl]hexan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54177211 |
| Molecular Formula | C25H33Cl3N2O4S2 |
| Molecular Weight | 596.04 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | 4-chloro-N-(2,5-dichlorophenyl)-N-[6-[(2R)-2-(methylsulfonylmethyl)piperidin-1-yl]hexan-2-yl]benzenesulfonamide |
| SMILES | CC(CCCCN1CCCC[C@@H]1CS(C)(=O)=O)N(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H33Cl3N2O4S2/c1-19(7-3-5-15-29-16-6-4-8-22(29)18-35(2,31)32)30(25-17-21(27)11-14-24(25)28)36(33,34)23-12-9-20(26)10-13-23/h9-14,17,19,22H,3-8,15-16,18H2,1-2H3/t19?,22-/m1/s1 |
| InChIKey | OZFXHSDAGRWHOO-AVKWCDSFSA-N |
| XLogP | 6.30 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.04 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|