C17H20ClN3O3S — CID 174588762
N-amino-N-[2-[benzenesulfonyl(butyl)amino]-5-chlorophenyl]formamide (PubChem CID 174588762) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is N-amino-N-[2-[benzenesulfonyl(butyl)amino]-5-chlorophenyl]formamide.
| Compound Name | N-amino-N-[2-[benzenesulfonyl(butyl)amino]-5-chlorophenyl]formamide |
|---|---|
| PubChem CID | 174588762 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-amino-N-[2-[benzenesulfonyl(butyl)amino]-5-chlorophenyl]formamide |
| SMILES | CCCCN(c1ccc(Cl)cc1N(N)C=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20ClN3O3S/c1-2-3-11-21(25(23,24)15-7-5-4-6-8-15)16-10-9-14(18)12-17(16)20(19)13-22/h4-10,12-13H,2-3,11,19H2,1H3 |
| InChIKey | ZWXMYSRAYKMNJW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|