C23H23ClN2O5S2 — CID 174492130
N-butyl-N-[4-chloro-2-(6-methylsulfonylpyridine-3-carbonyl)phenyl]benzenesulfonamide (PubChem CID 174492130) has the molecular formula C23H23ClN2O5S2 and a molecular weight of 507.03 g/mol. Its IUPAC name is N-butyl-N-[4-chloro-2-(6-methylsulfonylpyridine-3-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-butyl-N-[4-chloro-2-(6-methylsulfonylpyridine-3-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174492130 |
| Molecular Formula | C23H23ClN2O5S2 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | N-butyl-N-[4-chloro-2-(6-methylsulfonylpyridine-3-carbonyl)phenyl]benzenesulfonamide |
| SMILES | CCCCN(c1ccc(Cl)cc1C(=O)c1ccc(S(C)(=O)=O)nc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23ClN2O5S2/c1-3-4-14-26(33(30,31)19-8-6-5-7-9-19)21-12-11-18(24)15-20(21)23(27)17-10-13-22(25-16-17)32(2,28)29/h5-13,15-16H,3-4,14H2,1-2H3 |
| InChIKey | VIVWPRJQZVZZHQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |