C17H17BrCl2FNO2S — CID 70088605
N-[(4R)-4-bromopentyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide (PubChem CID 70088605) has the molecular formula C17H17BrCl2FNO2S and a molecular weight of 469.20 g/mol. Its IUPAC name is N-[(4R)-4-bromopentyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide.
| Compound Name | N-[(4R)-4-bromopentyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70088605 |
| Molecular Formula | C17H17BrCl2FNO2S |
| Molecular Weight | 469.20 g/mol |
| Exact Mass | 466.95 |
| IUPAC Name | N-[(4R)-4-bromopentyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
| SMILES | C[C@@H](Br)CCCN(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17BrCl2FNO2S/c1-12(18)3-2-10-22(17-11-14(20)6-9-16(17)21)25(23,24)15-7-4-13(19)5-8-15/h4-9,11-12H,2-3,10H2,1H3/t12-/m1/s1 |
| InChIKey | VYKBKHMMTSCLRM-GFCCVEGCSA-N |
| XLogP | 5.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.20 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|