C20H25Cl2FN2O3S — CID 157477834
(2R)-N-butyl-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propanamide;methane (PubChem CID 157477834) has the molecular formula C20H25Cl2FN2O3S and a molecular weight of 463.40 g/mol. Its IUPAC name is (2R)-N-butyl-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propanamide;methane.
| Compound Name | (2R)-N-butyl-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propanamide;methane |
|---|---|
| PubChem CID | 157477834 |
| Molecular Formula | C20H25Cl2FN2O3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (2R)-N-butyl-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propanamide;methane |
| SMILES | C.CCCCNC(=O)[C@@H](C)N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl2FN2O3S.CH4/c1-3-4-11-23-19(25)13(2)24(18-12-15(21)7-10-17(18)22)28(26,27)16-8-5-14(20)6-9-16;/h5-10,12-13H,3-4,11H2,1-2H3,(H,23,25);1H4/t13-;/m1./s1 |
| InChIKey | BVUNJVLYXTYVDY-BTQNPOSSSA-N |
| XLogP | 5.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|