C21H25Cl2FN6O4S — CID 161186653
[(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propyl] N-[3-(tetrazol-1-yl)propyl]carbamate;methane (PubChem CID 161186653) has the molecular formula C21H25Cl2FN6O4S and a molecular weight of 547.44 g/mol. Its IUPAC name is [(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propyl] N-[3-(tetrazol-1-yl)propyl]carbamate;methane.
| Compound Name | [(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propyl] N-[3-(tetrazol-1-yl)propyl]carbamate;methane |
|---|---|
| PubChem CID | 161186653 |
| Molecular Formula | C21H25Cl2FN6O4S |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | [(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)propyl] N-[3-(tetrazol-1-yl)propyl]carbamate;methane |
| SMILES | C.C[C@H](COC(=O)NCCCn1cnnn1)N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2FN6O4S.CH4/c1-14(12-33-20(30)24-9-2-10-28-13-25-26-27-28)29(19-11-16(22)5-8-18(19)23)34(31,32)17-6-3-15(21)4-7-17;/h3-8,11,13-14H,2,9-10,12H2,1H3,(H,24,30);1H4/t14-;/m1./s1 |
| InChIKey | UTDYZXPQGXOVAJ-PFEQFJNWSA-N |
| XLogP | 4.16 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|