C24H28Cl2N4O5S — CID 142014045
[(2R,3R)-3-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butan-2-yl] N-(3-imidazol-1-ylpropyl)carbamate (PubChem CID 142014045) has the molecular formula C24H28Cl2N4O5S and a molecular weight of 555.48 g/mol. Its IUPAC name is [(2R,3R)-3-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butan-2-yl] N-(3-imidazol-1-ylpropyl)carbamate.
| Compound Name | [(2R,3R)-3-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butan-2-yl] N-(3-imidazol-1-ylpropyl)carbamate |
|---|---|
| PubChem CID | 142014045 |
| Molecular Formula | C24H28Cl2N4O5S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | [(2R,3R)-3-[5-chloro-N-(4-chlorophenyl)sulfonyl-2-(hydroxymethyl)anilino]butan-2-yl] N-(3-imidazol-1-ylpropyl)carbamate |
| SMILES | C[C@H]([C@@H](C)OC(=O)NCCCn1ccnc1)N(c1cc(Cl)ccc1CO)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28Cl2N4O5S/c1-17(18(2)35-24(32)28-10-3-12-29-13-11-27-16-29)30(23-14-21(26)5-4-19(23)15-31)36(33,34)22-8-6-20(25)7-9-22/h4-9,11,13-14,16-18,31H,3,10,12,15H2,1-2H3,(H,28,32)/t17-,18-/m1/s1 |
| InChIKey | UNLPOJBOKVVNHE-QZTJIDSGSA-N |
| XLogP | 4.47 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|