C18H24Cl2N4O — CID 71916380
2-(3,5-dichlorophenyl)-2-(diethylamino)-N-(3-imidazol-1-ylpropyl)acetamide (PubChem CID 71916380) has the molecular formula C18H24Cl2N4O and a molecular weight of 383.32 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-2-(diethylamino)-N-(3-imidazol-1-ylpropyl)acetamide.
| Compound Name | 2-(3,5-dichlorophenyl)-2-(diethylamino)-N-(3-imidazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 71916380 |
| Molecular Formula | C18H24Cl2N4O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-2-(diethylamino)-N-(3-imidazol-1-ylpropyl)acetamide |
| SMILES | CCN(CC)C(C(=O)NCCCn1ccnc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H24Cl2N4O/c1-3-24(4-2)17(14-10-15(19)12-16(20)11-14)18(25)22-6-5-8-23-9-7-21-13-23/h7,9-13,17H,3-6,8H2,1-2H3,(H,22,25) |
| InChIKey | GOKJCOIBBIYEIK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|