C25H25ClF2N2O5S — CID 159598782
[2-[(1R)-1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenyl]methyl N-(2-methoxyethyl)carbamate (PubChem CID 159598782) has the molecular formula C25H25ClF2N2O5S and a molecular weight of 539.00 g/mol. Its IUPAC name is [2-[(1R)-1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenyl]methyl N-(2-methoxyethyl)carbamate.
| Compound Name | [2-[(1R)-1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenyl]methyl N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 159598782 |
| Molecular Formula | C25H25ClF2N2O5S |
| Molecular Weight | 539.00 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [2-[(1R)-1-(N-(4-chlorophenyl)sulfonyl-2,5-difluoroanilino)ethyl]phenyl]methyl N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)OCc1ccccc1[C@@H](C)N(c1cc(F)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClF2N2O5S/c1-17(22-6-4-3-5-18(22)16-35-25(31)29-13-14-34-2)30(24-15-20(27)9-12-23(24)28)36(32,33)21-10-7-19(26)8-11-21/h3-12,15,17H,13-14,16H2,1-2H3,(H,29,31)/t17-/m1/s1 |
| InChIKey | MLEPGBKCNMDYHS-QGZVFWFLSA-N |
| XLogP | 5.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.00 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|