C21H16Cl3FN2O4S — CID 22275637
2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-(5-chloro-2-hydroxyphenyl)propanamide (PubChem CID 22275637) has the molecular formula C21H16Cl3FN2O4S and a molecular weight of 517.79 g/mol. Its IUPAC name is 2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-(5-chloro-2-hydroxyphenyl)propanamide.
| Compound Name | 2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-(5-chloro-2-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 22275637 |
| Molecular Formula | C21H16Cl3FN2O4S |
| Molecular Weight | 517.79 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | 2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-(5-chloro-2-hydroxyphenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)ccc1O)N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16Cl3FN2O4S/c1-12(21(29)26-18-10-14(23)5-9-20(18)28)27(19-11-15(24)4-8-17(19)25)32(30,31)16-6-2-13(22)3-7-16/h2-12,28H,1H3,(H,26,29) |
| InChIKey | MQURQXWLNSQUQS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.79 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|