C24H21Cl2FN4O3S2 — CID 91551912
(2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-[[4-(4,5-dihydrothiadiazol-4-yl)phenyl]methyl]propanamide (PubChem CID 91551912) has the molecular formula C24H21Cl2FN4O3S2 and a molecular weight of 567.50 g/mol. Its IUPAC name is (2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-[[4-(4,5-dihydrothiadiazol-4-yl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-[[4-(4,5-dihydrothiadiazol-4-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 91551912 |
| Molecular Formula | C24H21Cl2FN4O3S2 |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | (2R)-2-(5-chloro-N-(4-chlorophenyl)sulfonyl-2-fluoroanilino)-N-[[4-(4,5-dihydrothiadiazol-4-yl)phenyl]methyl]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccc(C2CSN=N2)cc1)N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21Cl2FN4O3S2/c1-15(24(32)28-13-16-2-4-17(5-3-16)22-14-35-30-29-22)31(23-12-19(26)8-11-21(23)27)36(33,34)20-9-6-18(25)7-10-20/h2-12,15,22H,13-14H2,1H3,(H,28,32)/t15-,22?/m1/s1 |
| InChIKey | NMMOJDSWZYVJBZ-JGHKVMFLSA-N |
| XLogP | 6.19 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|