C26H27ClN2O4S — CID 155553043
(E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]-N-methylprop-2-enamide (PubChem CID 155553043) has the molecular formula C26H27ClN2O4S and a molecular weight of 499.03 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 155553043 |
| Molecular Formula | C26H27ClN2O4S |
| Molecular Weight | 499.03 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]-N-methylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCO)c2ccccc2CN(C)C(=O)/C=C/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H27ClN2O4S/c1-20-7-14-24(15-8-20)34(32,33)29(17-18-30)25-6-4-3-5-22(25)19-28(2)26(31)16-11-21-9-12-23(27)13-10-21/h3-16,30H,17-19H2,1-2H3/b16-11+ |
| InChIKey | LCXGKZQWVIKZKM-LFIBNONCSA-N |
| XLogP | 4.51 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.03 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|