C22H25F3N2O4S — CID 38273268
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 38273268) has the molecular formula C22H25F3N2O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 38273268 |
| Molecular Formula | C22H25F3N2O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)N(C)Cc2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N2O4S/c1-4-27(5-2)32(29,30)19-13-10-17(11-14-19)12-15-21(28)26(3)16-18-8-6-7-9-20(18)31-22(23,24)25/h6-15H,4-5,16H2,1-3H3/b15-12+ |
| InChIKey | WPYXIQSUTJLXIP-NTCAYCPXSA-N |
| XLogP | 4.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|