C21H23F3N2O4S — CID 24584151
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 24584151) has the molecular formula C21H23F3N2O4S and a molecular weight of 456.49 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24584151 |
| Molecular Formula | C21H23F3N2O4S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)NCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H23F3N2O4S/c1-3-26(4-2)31(28,29)19-12-7-16(8-13-19)9-14-20(27)25-15-17-5-10-18(11-6-17)30-21(22,23)24/h5-14H,3-4,15H2,1-2H3,(H,25,27)/b14-9+ |
| InChIKey | FMUIZVIZVUGWTJ-NTEUORMPSA-N |
| XLogP | 3.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|