C19H23N3O3S — CID 26591286
(E)-3-[4-(diethylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 26591286) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 26591286 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (E)-3-[4-(diethylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-3-22(4-2)26(24,25)18-10-7-16(8-11-18)9-12-19(23)21-15-17-6-5-13-20-14-17/h5-14H,3-4,15H2,1-2H3,(H,21,23)/b12-9+ |
| InChIKey | OBPCLDYTPOGOAL-FMIVXFBMSA-N |
| XLogP | 2.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|