C22H29N3O3S — CID 72690429
N-(3-anilinopropyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 72690429) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(3-anilinopropyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-(3-anilinopropyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72690429 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(3-anilinopropyl)-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C=CC(=O)NCCCNc2ccccc2)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-3-25(4-2)29(27,28)21-14-11-19(12-15-21)13-16-22(26)24-18-8-17-23-20-9-6-5-7-10-20/h5-7,9-16,23H,3-4,8,17-18H2,1-2H3,(H,24,26) |
| InChIKey | HPJJPGNBOJMRNB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|