C20H18F3NO5 — CID 33312057
(E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 33312057) has the molecular formula C20H18F3NO5 and a molecular weight of 409.36 g/mol. Its IUPAC name is (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 33312057 |
| Molecular Formula | C20H18F3NO5 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (E)-3-(5-methoxy-2,3-dihydro-1,4-benzodioxin-7-yl)-N-[[4-(trifluoromethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2ccc(OC(F)(F)F)cc2)cc2c1OCCO2 |
| InChI | InChI=1S/C20H18F3NO5/c1-26-16-10-14(11-17-19(16)28-9-8-27-17)4-7-18(25)24-12-13-2-5-15(6-3-13)29-20(21,22)23/h2-7,10-11H,8-9,12H2,1H3,(H,24,25)/b7-4+ |
| InChIKey | WCKQQNURSHMVIY-QPJJXVBHSA-N |
| XLogP | 3.69 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|