C22H27ClN2O4S — CID 26995573
(E)-N-[2-(2-chlorophenoxy)ethyl]-3-[4-(diethylsulfamoyl)phenyl]-N-methylprop-2-enamide (PubChem CID 26995573) has the molecular formula C22H27ClN2O4S and a molecular weight of 450.99 g/mol. Its IUPAC name is (E)-N-[2-(2-chlorophenoxy)ethyl]-3-[4-(diethylsulfamoyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[2-(2-chlorophenoxy)ethyl]-3-[4-(diethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26995573 |
| Molecular Formula | C22H27ClN2O4S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (E)-N-[2-(2-chlorophenoxy)ethyl]-3-[4-(diethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)N(C)CCOc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O4S/c1-4-25(5-2)30(27,28)19-13-10-18(11-14-19)12-15-22(26)24(3)16-17-29-21-9-7-6-8-20(21)23/h6-15H,4-5,16-17H2,1-3H3/b15-12+ |
| InChIKey | XLSRNUNIOMOVEZ-NTCAYCPXSA-N |
| XLogP | 3.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|