C23H23ClN2O4S2 — CID 155517897
(E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl(thiophen-3-ylsulfonyl)amino]phenyl]methyl]-N-methylprop-2-enamide (PubChem CID 155517897) has the molecular formula C23H23ClN2O4S2 and a molecular weight of 491.03 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl(thiophen-3-ylsulfonyl)amino]phenyl]methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl(thiophen-3-ylsulfonyl)amino]phenyl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 155517897 |
| Molecular Formula | C23H23ClN2O4S2 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[2-[2-hydroxyethyl(thiophen-3-ylsulfonyl)amino]phenyl]methyl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1ccccc1N(CCO)S(=O)(=O)c1ccsc1)C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN2O4S2/c1-25(23(28)11-8-18-6-9-20(24)10-7-18)16-19-4-2-3-5-22(19)26(13-14-27)32(29,30)21-12-15-31-17-21/h2-12,15,17,27H,13-14,16H2,1H3/b11-8+ |
| InChIKey | SBYBJCFFBMYOBP-DHZHZOJOSA-N |
| XLogP | 4.26 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|