C26H34ClNO2 — CID 57173697
3-(4-chlorophenyl)-N-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]-N-methylprop-2-enamide (PubChem CID 57173697) has the molecular formula C26H34ClNO2 and a molecular weight of 428.02 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]-N-methylprop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 57173697 |
| Molecular Formula | C26H34ClNO2 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]-N-methylprop-2-enamide |
| SMILES | CN(CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)C=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H34ClNO2/c1-25(2,3)21-16-19(17-22(24(21)30)26(4,5)6)14-15-28(7)23(29)13-10-18-8-11-20(27)12-9-18/h8-13,16-17,30H,14-15H2,1-7H3 |
| InChIKey | ZYNNIXVAZIOGCC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|