C26H33ClN2O3 — CID 88820904
N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide (PubChem CID 88820904) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide.
| Compound Name | N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 88820904 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N'-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-2-(3,5-ditert-butyl-4-hydroxyphenyl)propanehydrazide |
| SMILES | CC(C(=O)NNC(=O)/C=C/c1ccc(Cl)cc1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-16(18-14-20(25(2,3)4)23(31)21(15-18)26(5,6)7)24(32)29-28-22(30)13-10-17-8-11-19(27)12-9-17/h8-16,31H,1-7H3,(H,28,30)(H,29,32)/b13-10+ |
| InChIKey | SQXAIVNIZGFWQN-JLHYYAGUSA-N |
| XLogP | 5.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|