C16H16ClNO4S2 — CID 52822716
(E)-3-(4-chlorophenyl)-N-(3-hydroxypropyl)-N-thiophen-2-ylsulfonylprop-2-enamide (PubChem CID 52822716) has the molecular formula C16H16ClNO4S2 and a molecular weight of 385.89 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(3-hydroxypropyl)-N-thiophen-2-ylsulfonylprop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(3-hydroxypropyl)-N-thiophen-2-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 52822716 |
| Molecular Formula | C16H16ClNO4S2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(3-hydroxypropyl)-N-thiophen-2-ylsulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)N(CCCO)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H16ClNO4S2/c17-14-7-4-13(5-8-14)6-9-15(20)18(10-2-11-19)24(21,22)16-3-1-12-23-16/h1,3-9,12,19H,2,10-11H2/b9-6+ |
| InChIKey | SMKWKGXXOQBKSA-RMKNXTFCSA-N |
| XLogP | 3.01 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|