C12H20N2O4S2 — CID 43573487
N-(2-hydroxyethyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-propan-2-ylacetamide (PubChem CID 43573487) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-propan-2-ylacetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 43573487 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[methyl(thiophen-2-ylsulfonyl)amino]-N-propan-2-ylacetamide |
| SMILES | CC(C)N(CCO)C(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-10(2)14(6-7-15)11(16)9-13(3)20(17,18)12-5-4-8-19-12/h4-5,8,10,15H,6-7,9H2,1-3H3 |
| InChIKey | ZNDMYODXAQXZNS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |