C12H20N2O4S2 — CID 115770771
N-(4-hydroxy-3-methylbutan-2-yl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide (PubChem CID 115770771) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylbutan-2-yl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-(4-hydroxy-3-methylbutan-2-yl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 115770771 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-(4-hydroxy-3-methylbutan-2-yl)-2-[methyl(thiophen-2-ylsulfonyl)amino]acetamide |
| SMILES | CC(CO)C(C)NC(=O)CN(C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-9(8-15)10(2)13-11(16)7-14(3)20(17,18)12-5-4-6-19-12/h4-6,9-10,15H,7-8H2,1-3H3,(H,13,16) |
| InChIKey | WGVFLFNRLOLDKF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |