C16H14Cl3NO3S — CID 50890031
2-(N-(3,4-dichlorophenyl)sulfonyl-2-methylanilino)propanoyl chloride (PubChem CID 50890031) has the molecular formula C16H14Cl3NO3S and a molecular weight of 406.72 g/mol. Its IUPAC name is 2-(N-(3,4-dichlorophenyl)sulfonyl-2-methylanilino)propanoyl chloride.
| Compound Name | 2-(N-(3,4-dichlorophenyl)sulfonyl-2-methylanilino)propanoyl chloride |
|---|---|
| PubChem CID | 50890031 |
| Molecular Formula | C16H14Cl3NO3S |
| Molecular Weight | 406.72 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-(N-(3,4-dichlorophenyl)sulfonyl-2-methylanilino)propanoyl chloride |
| SMILES | Cc1ccccc1N(C(C)C(=O)Cl)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl3NO3S/c1-10-5-3-4-6-15(10)20(11(2)16(19)21)24(22,23)12-7-8-13(17)14(18)9-12/h3-9,11H,1-2H3 |
| InChIKey | KEXKMCKTDCRPLW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|