C23H23NO5S — CID 1283700
2-(2-methoxyphenoxy)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 1283700) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 1283700 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-(4-methylphenyl)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | COc1ccccc1OCC(=O)N(c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-17-8-12-19(13-9-17)24(30(26,27)20-14-10-18(2)11-15-20)23(25)16-29-22-7-5-4-6-21(22)28-3/h4-15H,16H2,1-3H3 |
| InChIKey | BABNONFVYBCCQU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |