C25H26BrNO4S — CID 19218232
2-(2-bromophenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 19218232) has the molecular formula C25H26BrNO4S and a molecular weight of 516.46 g/mol. Its IUPAC name is 2-(2-bromophenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-(2-bromophenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 19218232 |
| Molecular Formula | C25H26BrNO4S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 2-(2-bromophenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | CCCCc1ccc(N(C(=O)COc2ccccc2Br)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H26BrNO4S/c1-3-4-7-20-12-14-21(15-13-20)27(32(29,30)22-16-10-19(2)11-17-22)25(28)18-31-24-9-6-5-8-23(24)26/h5-6,8-17H,3-4,7,18H2,1-2H3 |
| InChIKey | ZIYQJHSBAHPRNO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |