C26H29NO4S — CID 19217557
N-(benzenesulfonyl)-N-(4-butylphenyl)-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 19217557) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(4-butylphenyl)-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-(benzenesulfonyl)-N-(4-butylphenyl)-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 19217557 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-(benzenesulfonyl)-N-(4-butylphenyl)-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | CCCCc1ccc(N(C(=O)COc2ccc(C)c(C)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO4S/c1-4-5-9-22-13-15-23(16-14-22)27(32(29,30)25-10-7-6-8-11-25)26(28)19-31-24-17-12-20(2)21(3)18-24/h6-8,10-18H,4-5,9,19H2,1-3H3 |
| InChIKey | NKKTZPQIOUGEJH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |