C23H22BrNO5S — CID 19217988
N-(benzenesulfonyl)-2-(4-bromo-3-methylphenoxy)-N-(4-ethoxyphenyl)acetamide (PubChem CID 19217988) has the molecular formula C23H22BrNO5S and a molecular weight of 504.40 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(4-bromo-3-methylphenoxy)-N-(4-ethoxyphenyl)acetamide.
| Compound Name | N-(benzenesulfonyl)-2-(4-bromo-3-methylphenoxy)-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19217988 |
| Molecular Formula | C23H22BrNO5S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | N-(benzenesulfonyl)-2-(4-bromo-3-methylphenoxy)-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(N(C(=O)COc2ccc(Br)c(C)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22BrNO5S/c1-3-29-19-11-9-18(10-12-19)25(31(27,28)21-7-5-4-6-8-21)23(26)16-30-20-13-14-22(24)17(2)15-20/h4-15H,3,16H2,1-2H3 |
| InChIKey | VNMUUSXOOWSCMQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |