C22H19BrClNO5S — CID 19217990
2-(4-bromo-3-methylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide (PubChem CID 19217990) has the molecular formula C22H19BrClNO5S and a molecular weight of 524.82 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19217990 |
| Molecular Formula | C22H19BrClNO5S |
| Molecular Weight | 524.82 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(C(=O)COc2ccc(Br)c(C)c2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H19BrClNO5S/c1-15-13-19(9-12-21(15)23)30-14-22(26)25(17-5-7-18(29-2)8-6-17)31(27,28)20-10-3-16(24)4-11-20/h3-13H,14H2,1-2H3 |
| InChIKey | VXVRLXKDNKHOPX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.82 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |