C25H26ClNO5S — CID 19217758
2-(2-tert-butylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide (PubChem CID 19217758) has the molecular formula C25H26ClNO5S and a molecular weight of 488.01 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19217758 |
| Molecular Formula | C25H26ClNO5S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-(4-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(C(=O)COc2ccccc2C(C)(C)C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H26ClNO5S/c1-25(2,3)22-7-5-6-8-23(22)32-17-24(28)27(19-11-13-20(31-4)14-12-19)33(29,30)21-15-9-18(26)10-16-21/h5-16H,17H2,1-4H3 |
| InChIKey | LCCKBVVRJFWKBM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |