C28H32ClNO4S — CID 19217762
2-(2-tert-butylphenoxy)-N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonylacetamide (PubChem CID 19217762) has the molecular formula C28H32ClNO4S and a molecular weight of 514.09 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonylacetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 19217762 |
| Molecular Formula | C28H32ClNO4S |
| Molecular Weight | 514.09 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonylacetamide |
| SMILES | CCCCc1ccc(N(C(=O)COc2ccccc2C(C)(C)C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H32ClNO4S/c1-5-6-9-21-12-16-23(17-13-21)30(35(32,33)24-18-14-22(29)15-19-24)27(31)20-34-26-11-8-7-10-25(26)28(2,3)4/h7-8,10-19H,5-6,9,20H2,1-4H3 |
| InChIKey | MNZBPJXHLKANDK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.09 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |