C27H30BrNO4S — CID 19219771
2-(4-bromo-2-ethylphenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 19219771) has the molecular formula C27H30BrNO4S and a molecular weight of 544.51 g/mol. Its IUPAC name is 2-(4-bromo-2-ethylphenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-(4-bromo-2-ethylphenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 19219771 |
| Molecular Formula | C27H30BrNO4S |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2-(4-bromo-2-ethylphenoxy)-N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | CCCCc1ccc(N(C(=O)COc2ccc(Br)cc2CC)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H30BrNO4S/c1-4-6-7-21-10-13-24(14-11-21)29(34(31,32)25-15-8-20(3)9-16-25)27(30)19-33-26-17-12-23(28)18-22(26)5-2/h8-18H,4-7,19H2,1-3H3 |
| InChIKey | XCQFJMBTAZKNIW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |