C24H24BrNO4S — CID 19219981
N-(benzenesulfonyl)-2-(2-bromo-4-ethylphenoxy)-N-(4-ethylphenyl)acetamide (PubChem CID 19219981) has the molecular formula C24H24BrNO4S and a molecular weight of 502.43 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(2-bromo-4-ethylphenoxy)-N-(4-ethylphenyl)acetamide.
| Compound Name | N-(benzenesulfonyl)-2-(2-bromo-4-ethylphenoxy)-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 19219981 |
| Molecular Formula | C24H24BrNO4S |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | N-(benzenesulfonyl)-2-(2-bromo-4-ethylphenoxy)-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(N(C(=O)COc2ccc(CC)cc2Br)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24BrNO4S/c1-3-18-10-13-20(14-11-18)26(31(28,29)21-8-6-5-7-9-21)24(27)17-30-23-15-12-19(4-2)16-22(23)25/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | NORMYNSWAKZPBQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |