C23H23NO4S — CID 19212677
N-(benzenesulfonyl)-N-(4-ethylphenyl)-2-(4-methylphenoxy)acetamide (PubChem CID 19212677) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(4-ethylphenyl)-2-(4-methylphenoxy)acetamide.
| Compound Name | N-(benzenesulfonyl)-N-(4-ethylphenyl)-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 19212677 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-(benzenesulfonyl)-N-(4-ethylphenyl)-2-(4-methylphenoxy)acetamide |
| SMILES | CCc1ccc(N(C(=O)COc2ccc(C)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-3-19-11-13-20(14-12-19)24(29(26,27)22-7-5-4-6-8-22)23(25)17-28-21-15-9-18(2)10-16-21/h4-16H,3,17H2,1-2H3 |
| InChIKey | CHALYHSSSZZQBV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |