C27H31NO4S — CID 19218327
N-(4-ethylphenyl)-N-(4-methylphenyl)sulfonyl-2-(3-methyl-4-propan-2-ylphenoxy)acetamide (PubChem CID 19218327) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N-(4-methylphenyl)sulfonyl-2-(3-methyl-4-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(4-ethylphenyl)-N-(4-methylphenyl)sulfonyl-2-(3-methyl-4-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 19218327 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-(4-ethylphenyl)-N-(4-methylphenyl)sulfonyl-2-(3-methyl-4-propan-2-ylphenoxy)acetamide |
| SMILES | CCc1ccc(N(C(=O)COc2ccc(C(C)C)c(C)c2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H31NO4S/c1-6-22-9-11-23(12-10-22)28(33(30,31)25-14-7-20(4)8-15-25)27(29)18-32-24-13-16-26(19(2)3)21(5)17-24/h7-17,19H,6,18H2,1-5H3 |
| InChIKey | DKARDBJHGXTUAO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |