C29H35NO4S — CID 19212810
N-(4-butylphenyl)-N-(4-methylphenyl)sulfonyl-2-(5-methyl-2-propan-2-ylphenoxy)acetamide (PubChem CID 19212810) has the molecular formula C29H35NO4S and a molecular weight of 493.67 g/mol. Its IUPAC name is N-(4-butylphenyl)-N-(4-methylphenyl)sulfonyl-2-(5-methyl-2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(4-butylphenyl)-N-(4-methylphenyl)sulfonyl-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 19212810 |
| Molecular Formula | C29H35NO4S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-(4-butylphenyl)-N-(4-methylphenyl)sulfonyl-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
| SMILES | CCCCc1ccc(N(C(=O)COc2cc(C)ccc2C(C)C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H35NO4S/c1-6-7-8-24-12-14-25(15-13-24)30(35(32,33)26-16-9-22(4)10-17-26)29(31)20-34-28-19-23(5)11-18-27(28)21(2)3/h9-19,21H,6-8,20H2,1-5H3 |
| InChIKey | CFSFDUCQLZPSRH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |