C21H17Cl2NO5S — CID 19217653
N-(benzenesulfonyl)-2-(2,5-dichlorophenoxy)-N-(4-methoxyphenyl)acetamide (PubChem CID 19217653) has the molecular formula C21H17Cl2NO5S and a molecular weight of 466.34 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-(2,5-dichlorophenoxy)-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-(benzenesulfonyl)-2-(2,5-dichlorophenoxy)-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 19217653 |
| Molecular Formula | C21H17Cl2NO5S |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | N-(benzenesulfonyl)-2-(2,5-dichlorophenoxy)-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(C(=O)COc2cc(Cl)ccc2Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17Cl2NO5S/c1-28-17-10-8-16(9-11-17)24(30(26,27)18-5-3-2-4-6-18)21(25)14-29-20-13-15(22)7-12-19(20)23/h2-13H,14H2,1H3 |
| InChIKey | SSMULHOVJDYIEE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |