C22H20ClNO6S — CID 19220173
N-(benzenesulfonyl)-N-(3-chloro-4-methoxyphenyl)-2-(3-methoxyphenoxy)acetamide (PubChem CID 19220173) has the molecular formula C22H20ClNO6S and a molecular weight of 461.92 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(3-chloro-4-methoxyphenyl)-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-(benzenesulfonyl)-N-(3-chloro-4-methoxyphenyl)-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 19220173 |
| Molecular Formula | C22H20ClNO6S |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N-(benzenesulfonyl)-N-(3-chloro-4-methoxyphenyl)-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)N(c2ccc(OC)c(Cl)c2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H20ClNO6S/c1-28-17-7-6-8-18(14-17)30-15-22(25)24(16-11-12-21(29-2)20(23)13-16)31(26,27)19-9-4-3-5-10-19/h3-14H,15H2,1-2H3 |
| InChIKey | JIGPDCRWWJRMMW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |