C26H28ClNO5S — CID 19217802
2-(4-tert-butylphenoxy)-N-(3-chloro-4-methoxyphenyl)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 19217802) has the molecular formula C26H28ClNO5S and a molecular weight of 502.03 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-(3-chloro-4-methoxyphenyl)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-(3-chloro-4-methoxyphenyl)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 19217802 |
| Molecular Formula | C26H28ClNO5S |
| Molecular Weight | 502.03 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-(3-chloro-4-methoxyphenyl)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | COc1ccc(N(C(=O)COc2ccc(C(C)(C)C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C26H28ClNO5S/c1-18-6-13-22(14-7-18)34(30,31)28(20-10-15-24(32-5)23(27)16-20)25(29)17-33-21-11-8-19(9-12-21)26(2,3)4/h6-16H,17H2,1-5H3 |
| InChIKey | UBICRMQHESIXPO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |