C18H21NO4S2 — CID 165344616
methyl 3-(N-(4-methylphenyl)sulfonyl-2-methylsulfanylanilino)propanoate (PubChem CID 165344616) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is methyl 3-(N-(4-methylphenyl)sulfonyl-2-methylsulfanylanilino)propanoate.
| Compound Name | methyl 3-(N-(4-methylphenyl)sulfonyl-2-methylsulfanylanilino)propanoate |
|---|---|
| PubChem CID | 165344616 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | methyl 3-(N-(4-methylphenyl)sulfonyl-2-methylsulfanylanilino)propanoate |
| SMILES | COC(=O)CCN(c1ccccc1SC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO4S2/c1-14-8-10-15(11-9-14)25(21,22)19(13-12-18(20)23-2)16-6-4-5-7-17(16)24-3/h4-11H,12-13H2,1-3H3 |
| InChIKey | NTNNVIUPJDDLPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |